ChemNet > CAS > 5019-82-9 Bicyclo[3.2.1]octan-2-one
5019-82-9 Bicyclo[3.2.1]octan-2-one
상품명칭 |
Bicyclo[3.2.1]octan-2-one |
영문 이름 |
Bicyclo[3.2.1]octan-2-one; bicyclo(3.2.1)octan-2-one |
분자식 |
C8H12O |
분자량 |
124.1803 |
InChI |
InChI=1/C8H12O/c9-8-4-2-6-1-3-7(8)5-6/h6-7H,1-5H2 |
cas번호 |
5019-82-9 |
EC번호 |
225-704-7 |
분자 구조 |
|
밀도 |
1.039g/cm3 |
녹는 점 |
118-124℃ |
비등점 |
201.6°C at 760 mmHg |
굴절 지수 |
1.499 |
인화점 |
68.7°C |
증기압 |
0.305mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|